C16H14N6O3S2 — CID 2612889
6-amino-1,3-dimethyl-5-[2-([1,2,4]triazolo[3,4-b][1,3]benzothiazol-1-ylsulfanyl)acetyl]pyrimidine-2,4-dione (PubChem CID 2612889) has the molecular formula C16H14N6O3S2 and a molecular weight of 402.46 g/mol. Its IUPAC name is 6-amino-1,3-dimethyl-5-[2-([1,2,4]triazolo[3,4-b][1,3]benzothiazol-1-ylsulfanyl)acetyl]pyrimidine-2,4-dione.
| Compound Name | 6-amino-1,3-dimethyl-5-[2-([1,2,4]triazolo[3,4-b][1,3]benzothiazol-1-ylsulfanyl)acetyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 2612889 |
| Molecular Formula | C16H14N6O3S2 |
| Molecular Weight | 402.46 g/mol |
| Exact Mass | 402.06 |
| IUPAC Name | 6-amino-1,3-dimethyl-5-[2-([1,2,4]triazolo[3,4-b][1,3]benzothiazol-1-ylsulfanyl)acetyl]pyrimidine-2,4-dione |
| SMILES | Cn1c(N)c(C(=O)CSc2nnc3sc4ccccc4n23)c(=O)n(C)c1=O |
| InChI | InChI=1S/C16H14N6O3S2/c1-20-12(17)11(13(24)21(2)16(20)25)9(23)7-26-14-18-19-15-22(14)8-5-3-4-6-10(8)27-15/h3-6H,7,17H2,1-2H3 |
| InChIKey | XUGYDNJKCANIOI-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 117.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.46 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |