C18H19N5O — CID 26171953
N-[(1S)-1-(2,5-dimethylphenyl)ethyl]-3-(tetrazol-1-yl)benzamide (PubChem CID 26171953) has the molecular formula C18H19N5O and a molecular weight of 321.38 g/mol. Its IUPAC name is N-[(1S)-1-(2,5-dimethylphenyl)ethyl]-3-(tetrazol-1-yl)benzamide.
| Compound Name | N-[(1S)-1-(2,5-dimethylphenyl)ethyl]-3-(tetrazol-1-yl)benzamide |
|---|---|
| PubChem CID | 26171953 |
| Molecular Formula | C18H19N5O |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.16 |
| IUPAC Name | N-[(1S)-1-(2,5-dimethylphenyl)ethyl]-3-(tetrazol-1-yl)benzamide |
| SMILES | Cc1ccc(C)c([C@H](C)NC(=O)c2cccc(-n3cnnn3)c2)c1 |
| InChI | InChI=1S/C18H19N5O/c1-12-7-8-13(2)17(9-12)14(3)20-18(24)15-5-4-6-16(10-15)23-11-19-21-22-23/h4-11,14H,1-3H3,(H,20,24)/t14-/m0/s1 |
| InChIKey | PENODYKKXSJWNV-AWEZNQCLSA-N |
| XLogP | 2.77 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |