C17H18INO — CID 95356346
N-[(1R)-1-(2,5-dimethylphenyl)ethyl]-3-iodobenzamide (PubChem CID 95356346) has the molecular formula C17H18INO and a molecular weight of 379.24 g/mol. Its IUPAC name is N-[(1R)-1-(2,5-dimethylphenyl)ethyl]-3-iodobenzamide.
| Compound Name | N-[(1R)-1-(2,5-dimethylphenyl)ethyl]-3-iodobenzamide |
|---|---|
| PubChem CID | 95356346 |
| Molecular Formula | C17H18INO |
| Molecular Weight | 379.24 g/mol |
| Exact Mass | 379.04 |
| IUPAC Name | N-[(1R)-1-(2,5-dimethylphenyl)ethyl]-3-iodobenzamide |
| SMILES | Cc1ccc(C)c([C@@H](C)NC(=O)c2cccc(I)c2)c1 |
| InChI | InChI=1S/C17H18INO/c1-11-7-8-12(2)16(9-11)13(3)19-17(20)14-5-4-6-15(18)10-14/h4-10,13H,1-3H3,(H,19,20)/t13-/m1/s1 |
| InChIKey | FPSYDWOAOUWJOY-CYBMUJFWSA-N |
| XLogP | 4.40 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.24 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|