C22H25NO7 — CID 26176842
methyl 4,5-dimethoxy-2-[[2-(2-methoxy-4-prop-2-enylphenoxy)acetyl]amino]benzoate (PubChem CID 26176842) has the molecular formula C22H25NO7 and a molecular weight of 415.44 g/mol. Its IUPAC name is methyl 4,5-dimethoxy-2-[[2-(2-methoxy-4-prop-2-enylphenoxy)acetyl]amino]benzoate.
| Compound Name | methyl 4,5-dimethoxy-2-[[2-(2-methoxy-4-prop-2-enylphenoxy)acetyl]amino]benzoate |
|---|---|
| PubChem CID | 26176842 |
| Molecular Formula | C22H25NO7 |
| Molecular Weight | 415.44 g/mol |
| Exact Mass | 415.16 |
| IUPAC Name | methyl 4,5-dimethoxy-2-[[2-(2-methoxy-4-prop-2-enylphenoxy)acetyl]amino]benzoate |
| SMILES | C=CCc1ccc(OCC(=O)Nc2cc(OC)c(OC)cc2C(=O)OC)c(OC)c1 |
| InChI | InChI=1S/C22H25NO7/c1-6-7-14-8-9-17(18(10-14)26-2)30-13-21(24)23-16-12-20(28-4)19(27-3)11-15(16)22(25)29-5/h6,8-12H,1,7,13H2,2-5H3,(H,23,24) |
| InChIKey | LKIIGHLRWZWHIE-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.44 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|