C21H24N2O4S — CID 56529727
S-[4-[[2-(2-methoxy-4-prop-2-enylphenoxy)acetyl]amino]phenyl] N,N-dimethylcarbamothioate (PubChem CID 56529727) has the molecular formula C21H24N2O4S and a molecular weight of 400.50 g/mol. Its IUPAC name is S-[4-[[2-(2-methoxy-4-prop-2-enylphenoxy)acetyl]amino]phenyl] N,N-dimethylcarbamothioate.
| Compound Name | S-[4-[[2-(2-methoxy-4-prop-2-enylphenoxy)acetyl]amino]phenyl] N,N-dimethylcarbamothioate |
|---|---|
| PubChem CID | 56529727 |
| Molecular Formula | C21H24N2O4S |
| Molecular Weight | 400.50 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | S-[4-[[2-(2-methoxy-4-prop-2-enylphenoxy)acetyl]amino]phenyl] N,N-dimethylcarbamothioate |
| SMILES | C=CCc1ccc(OCC(=O)Nc2ccc(SC(=O)N(C)C)cc2)c(OC)c1 |
| InChI | InChI=1S/C21H24N2O4S/c1-5-6-15-7-12-18(19(13-15)26-4)27-14-20(24)22-16-8-10-17(11-9-16)28-21(25)23(2)3/h5,7-13H,1,6,14H2,2-4H3,(H,22,24) |
| InChIKey | IIKRSKMSFAWJAJ-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.50 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|