C24H25N3O4 — CID 26179573
(7-methyl-2-oxochromen-4-yl)methyl 1,6-di(propan-2-yl)pyrazolo[5,4-b]pyridine-4-carboxylate (PubChem CID 26179573) has the molecular formula C24H25N3O4 and a molecular weight of 419.48 g/mol. Its IUPAC name is (7-methyl-2-oxochromen-4-yl)methyl 1,6-di(propan-2-yl)pyrazolo[5,4-b]pyridine-4-carboxylate.
| Compound Name | (7-methyl-2-oxochromen-4-yl)methyl 1,6-di(propan-2-yl)pyrazolo[5,4-b]pyridine-4-carboxylate |
|---|---|
| PubChem CID | 26179573 |
| Molecular Formula | C24H25N3O4 |
| Molecular Weight | 419.48 g/mol |
| Exact Mass | 419.18 |
| IUPAC Name | (7-methyl-2-oxochromen-4-yl)methyl 1,6-di(propan-2-yl)pyrazolo[5,4-b]pyridine-4-carboxylate |
| SMILES | Cc1ccc2c(COC(=O)c3cc(C(C)C)nc4c3cnn4C(C)C)cc(=O)oc2c1 |
| InChI | InChI=1S/C24H25N3O4/c1-13(2)20-10-18(19-11-25-27(14(3)4)23(19)26-20)24(29)30-12-16-9-22(28)31-21-8-15(5)6-7-17(16)21/h6-11,13-14H,12H2,1-5H3 |
| InChIKey | SFZKIDJFESTEMX-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 87.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.48 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|