C11H16Cl2N2O4 — CID 2619024
[2-oxo-2-(propylcarbamoylamino)ethyl] (1R)-2,2-dichloro-1-methylcyclopropane-1-carboxylate (PubChem CID 2619024) has the molecular formula C11H16Cl2N2O4 and a molecular weight of 311.17 g/mol. Its IUPAC name is [2-oxo-2-(propylcarbamoylamino)ethyl] (1R)-2,2-dichloro-1-methylcyclopropane-1-carboxylate.
| Compound Name | [2-oxo-2-(propylcarbamoylamino)ethyl] (1R)-2,2-dichloro-1-methylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 2619024 |
| Molecular Formula | C11H16Cl2N2O4 |
| Molecular Weight | 311.17 g/mol |
| Exact Mass | 310.05 |
| IUPAC Name | [2-oxo-2-(propylcarbamoylamino)ethyl] (1R)-2,2-dichloro-1-methylcyclopropane-1-carboxylate |
| SMILES | CCCNC(=O)NC(=O)COC(=O)[C@@]1(C)CC1(Cl)Cl |
| InChI | InChI=1S/C11H16Cl2N2O4/c1-3-4-14-9(18)15-7(16)5-19-8(17)10(2)6-11(10,12)13/h3-6H2,1-2H3,(H2,14,15,16,18)/t10-/m1/s1 |
| InChIKey | SNVJBYAAHOHKRJ-SNVBAGLBSA-N |
| XLogP | 1.35 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.17 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|