C11H14Cl2N2O4 — CID 2627415
[2-oxo-2-(prop-2-enylcarbamoylamino)ethyl] (1S)-2,2-dichloro-1-methylcyclopropane-1-carboxylate (PubChem CID 2627415) has the molecular formula C11H14Cl2N2O4 and a molecular weight of 309.15 g/mol. Its IUPAC name is [2-oxo-2-(prop-2-enylcarbamoylamino)ethyl] (1S)-2,2-dichloro-1-methylcyclopropane-1-carboxylate.
| Compound Name | [2-oxo-2-(prop-2-enylcarbamoylamino)ethyl] (1S)-2,2-dichloro-1-methylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 2627415 |
| Molecular Formula | C11H14Cl2N2O4 |
| Molecular Weight | 309.15 g/mol |
| Exact Mass | 308.03 |
| IUPAC Name | [2-oxo-2-(prop-2-enylcarbamoylamino)ethyl] (1S)-2,2-dichloro-1-methylcyclopropane-1-carboxylate |
| SMILES | C=CCNC(=O)NC(=O)COC(=O)[C@]1(C)CC1(Cl)Cl |
| InChI | InChI=1S/C11H14Cl2N2O4/c1-3-4-14-9(18)15-7(16)5-19-8(17)10(2)6-11(10,12)13/h3H,1,4-6H2,2H3,(H2,14,15,16,18)/t10-/m0/s1 |
| InChIKey | ADVCSYMCEZNCJI-JTQLQIEISA-N |
| XLogP | 1.13 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.15 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|