C15H12O3S — CID 26193520
[(2R)-2-hydroxy-4-(5-penta-1,3-diynylthiophen-2-yl)but-3-ynyl] acetate (PubChem CID 26193520) has the molecular formula C15H12O3S and a molecular weight of 272.32 g/mol. Its IUPAC name is [(2R)-2-hydroxy-4-(5-penta-1,3-diynylthiophen-2-yl)but-3-ynyl] acetate.
| Compound Name | [(2R)-2-hydroxy-4-(5-penta-1,3-diynylthiophen-2-yl)but-3-ynyl] acetate |
|---|---|
| PubChem CID | 26193520 |
| Molecular Formula | C15H12O3S |
| Molecular Weight | 272.32 g/mol |
| Exact Mass | 272.05 |
| IUPAC Name | [(2R)-2-hydroxy-4-(5-penta-1,3-diynylthiophen-2-yl)but-3-ynyl] acetate |
| SMILES | CC#CC#Cc1ccc(C#C[C@@H](O)COC(C)=O)s1 |
| InChI | InChI=1S/C15H12O3S/c1-3-4-5-6-14-9-10-15(19-14)8-7-13(17)11-18-12(2)16/h9-10,13,17H,11H2,1-2H3/t13-/m1/s1 |
| InChIKey | GDUMYEJFTMGMBO-CYBMUJFWSA-N |
| XLogP | 1.40 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.32 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|