C13H10O2S — CID 25014552
4-(5-penta-1,3-diynylthiophen-2-yl)but-3-yne-1,2-diol (PubChem CID 25014552) has the molecular formula C13H10O2S and a molecular weight of 230.29 g/mol. Its IUPAC name is 4-(5-penta-1,3-diynylthiophen-2-yl)but-3-yne-1,2-diol.
| Compound Name | 4-(5-penta-1,3-diynylthiophen-2-yl)but-3-yne-1,2-diol |
|---|---|
| PubChem CID | 25014552 |
| Molecular Formula | C13H10O2S |
| Molecular Weight | 230.29 g/mol |
| Exact Mass | 230.04 |
| IUPAC Name | 4-(5-penta-1,3-diynylthiophen-2-yl)but-3-yne-1,2-diol |
| SMILES | CC#CC#Cc1ccc(C#CC(O)CO)s1 |
| InChI | InChI=1S/C13H10O2S/c1-2-3-4-5-12-8-9-13(16-12)7-6-11(15)10-14/h8-9,11,14-15H,10H2,1H3 |
| InChIKey | MZCFHXFKOQBSQU-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.29 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|