C13H12O2S — CID 134145950
1-[5-[(Z)-hept-5-en-1,3-diynyl]thiophen-2-yl]ethane-1,2-diol (PubChem CID 134145950) has the molecular formula C13H12O2S and a molecular weight of 232.30 g/mol. Its IUPAC name is 1-[5-[(Z)-hept-5-en-1,3-diynyl]thiophen-2-yl]ethane-1,2-diol.
| Compound Name | 1-[5-[(Z)-hept-5-en-1,3-diynyl]thiophen-2-yl]ethane-1,2-diol |
|---|---|
| PubChem CID | 134145950 |
| Molecular Formula | C13H12O2S |
| Molecular Weight | 232.30 g/mol |
| Exact Mass | 232.06 |
| IUPAC Name | 1-[5-[(Z)-hept-5-en-1,3-diynyl]thiophen-2-yl]ethane-1,2-diol |
| SMILES | C/C=C\C#CC#Cc1ccc(C(O)CO)s1 |
| InChI | InChI=1S/C13H12O2S/c1-2-3-4-5-6-7-11-8-9-13(16-11)12(15)10-14/h2-3,8-9,12,14-15H,10H2,1H3/b3-2- |
| InChIKey | RCBXJOCDSLBWEX-IHWYPQMZSA-N |
| XLogP | 1.70 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.30 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|