About [5-[(E)-hept-5-en-1,3-diynyl]thiophen-2-yl]methanol
[5-[(E)-hept-5-en-1,3-diynyl]thiophen-2-yl]methanol (PubChem CID 44583855) has the molecular formula C12H10OS
and a molecular weight of 202.28 g/mol. Its IUPAC name is [5-[(E)-hept-5-en-1,3-diynyl]thiophen-2-yl]methanol.
Molecular Properties
| Compound Name | [5-[(E)-hept-5-en-1,3-diynyl]thiophen-2-yl]methanol |
| PubChem CID | 44583855 |
| Molecular Formula | C12H10OS |
| Molecular Weight | 202.28 g/mol |
| Exact Mass | 202.05 |
| IUPAC Name | [5-[(E)-hept-5-en-1,3-diynyl]thiophen-2-yl]methanol |
| SMILES | C/C=C/C#CC#Cc1ccc(CO)s1 |
| InChI | InChI=1S/C12H10OS/c1-2-3-4-5-6-7-11-8-9-12(10-13)14-11/h2-3,8-9,13H,10H2,1H3/b3-2+ |
| InChIKey | XFCGMIGOOIZCKE-NSCUHMNNSA-N |
| XLogP | 2.17 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.28 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze [5-[(E)-hept-5-en-1,3-diynyl]thiophen-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-[(E)-hept-5-en-1,3-diynyl]thiophen-2-yl]methanol?
The IUPAC name of [5-[(E)-hept-5-en-1,3-diynyl]thiophen-2-yl]methanol (CID 44583855) is [5-[(E)-hept-5-en-1,3-diynyl]thiophen-2-yl]methanol.
What is the SMILES notation for [5-[(E)-hept-5-en-1,3-diynyl]thiophen-2-yl]methanol?
The canonical SMILES for [5-[(E)-hept-5-en-1,3-diynyl]thiophen-2-yl]methanol is C/C=C/C#CC#Cc1ccc(CO)s1.
What is the InChIKey of [5-[(E)-hept-5-en-1,3-diynyl]thiophen-2-yl]methanol?
The InChIKey is XFCGMIGOOIZCKE-NSCUHMNNSA-N. The full InChI is InChI=1S/C12H10OS/c1-2-3-4-5-6-7-11-8-9-12(10-13)14-11/h2-3,8-9,13H,10H2,1H3/b3-2+.
What are the key properties of [5-[(E)-hept-5-en-1,3-diynyl]thiophen-2-yl]methanol?
[5-[(E)-hept-5-en-1,3-diynyl]thiophen-2-yl]methanol has a molecular weight of 202.28 g/mol, XLogP of 2.17, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [5-[(E)-hept-5-en-1,3-diynyl]thiophen-2-yl]methanol is sourced from PubChem (CID 44583855), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).