C16H16N4O3 — CID 26197496
(4-propoxyphenyl) 7-methyl-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxylate (PubChem CID 26197496) has the molecular formula C16H16N4O3 and a molecular weight of 312.33 g/mol. Its IUPAC name is (4-propoxyphenyl) 7-methyl-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxylate.
| Compound Name | (4-propoxyphenyl) 7-methyl-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxylate |
|---|---|
| PubChem CID | 26197496 |
| Molecular Formula | C16H16N4O3 |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | (4-propoxyphenyl) 7-methyl-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxylate |
| SMILES | CCCOc1ccc(OC(=O)c2nc3nccc(C)n3n2)cc1 |
| InChI | InChI=1S/C16H16N4O3/c1-3-10-22-12-4-6-13(7-5-12)23-15(21)14-18-16-17-9-8-11(2)20(16)19-14/h4-9H,3,10H2,1-2H3 |
| InChIKey | AKGBONCZASOOFR-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 78.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|