C23H29ClN2O4S — CID 26198372
N-(3-chloro-2,6-diethylphenyl)-3-(cyclopentylsulfamoyl)-4-methoxybenzamide (PubChem CID 26198372) has the molecular formula C23H29ClN2O4S and a molecular weight of 465.02 g/mol. Its IUPAC name is N-(3-chloro-2,6-diethylphenyl)-3-(cyclopentylsulfamoyl)-4-methoxybenzamide.
| Compound Name | N-(3-chloro-2,6-diethylphenyl)-3-(cyclopentylsulfamoyl)-4-methoxybenzamide |
|---|---|
| PubChem CID | 26198372 |
| Molecular Formula | C23H29ClN2O4S |
| Molecular Weight | 465.02 g/mol |
| Exact Mass | 464.15 |
| IUPAC Name | N-(3-chloro-2,6-diethylphenyl)-3-(cyclopentylsulfamoyl)-4-methoxybenzamide |
| SMILES | CCc1ccc(Cl)c(CC)c1NC(=O)c1ccc(OC)c(S(=O)(=O)NC2CCCC2)c1 |
| InChI | InChI=1S/C23H29ClN2O4S/c1-4-15-10-12-19(24)18(5-2)22(15)25-23(27)16-11-13-20(30-3)21(14-16)31(28,29)26-17-8-6-7-9-17/h10-14,17,26H,4-9H2,1-3H3,(H,25,27) |
| InChIKey | TWIPGUOTGGBKEX-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.02 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |