C21H27ClN2O3S — CID 26200265
N-(2-chloro-4,6-dimethylphenyl)-3-(dipropylsulfamoyl)benzamide (PubChem CID 26200265) has the molecular formula C21H27ClN2O3S and a molecular weight of 422.98 g/mol. Its IUPAC name is N-(2-chloro-4,6-dimethylphenyl)-3-(dipropylsulfamoyl)benzamide.
| Compound Name | N-(2-chloro-4,6-dimethylphenyl)-3-(dipropylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 26200265 |
| Molecular Formula | C21H27ClN2O3S |
| Molecular Weight | 422.98 g/mol |
| Exact Mass | 422.14 |
| IUPAC Name | N-(2-chloro-4,6-dimethylphenyl)-3-(dipropylsulfamoyl)benzamide |
| SMILES | CCCN(CCC)S(=O)(=O)c1cccc(C(=O)Nc2c(C)cc(C)cc2Cl)c1 |
| InChI | InChI=1S/C21H27ClN2O3S/c1-5-10-24(11-6-2)28(26,27)18-9-7-8-17(14-18)21(25)23-20-16(4)12-15(3)13-19(20)22/h7-9,12-14H,5-6,10-11H2,1-4H3,(H,23,25) |
| InChIKey | OYWJGFBMYUXTLA-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.98 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |