C21H31N3O5S — CID 26207316
3-(N-[2-[cyclopentyl-[(3R)-1,1-dioxothiolan-3-yl]amino]-2-oxoethyl]-4-methoxyanilino)propanamide (PubChem CID 26207316) has the molecular formula C21H31N3O5S and a molecular weight of 437.56 g/mol. Its IUPAC name is 3-(N-[2-[cyclopentyl-[(3R)-1,1-dioxothiolan-3-yl]amino]-2-oxoethyl]-4-methoxyanilino)propanamide.
| Compound Name | 3-(N-[2-[cyclopentyl-[(3R)-1,1-dioxothiolan-3-yl]amino]-2-oxoethyl]-4-methoxyanilino)propanamide |
|---|---|
| PubChem CID | 26207316 |
| Molecular Formula | C21H31N3O5S |
| Molecular Weight | 437.56 g/mol |
| Exact Mass | 437.20 |
| IUPAC Name | 3-(N-[2-[cyclopentyl-[(3R)-1,1-dioxothiolan-3-yl]amino]-2-oxoethyl]-4-methoxyanilino)propanamide |
| SMILES | COc1ccc(N(CCC(N)=O)CC(=O)N(C2CCCC2)[C@@H]2CCS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C21H31N3O5S/c1-29-19-8-6-16(7-9-19)23(12-10-20(22)25)14-21(26)24(17-4-2-3-5-17)18-11-13-30(27,28)15-18/h6-9,17-18H,2-5,10-15H2,1H3,(H2,22,25)/t18-/m1/s1 |
| InChIKey | GQLWFTKLNAPODA-GOSISDBHSA-N |
| XLogP | 1.34 |
| TPSA | 110.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.56 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|