C18H18N2O6S — CID 2620779
[2-[(3-carbamoylthiophen-2-yl)amino]-2-oxoethyl] 2-(4-propanoylphenoxy)acetate (PubChem CID 2620779) has the molecular formula C18H18N2O6S and a molecular weight of 390.42 g/mol. Its IUPAC name is [2-[(3-carbamoylthiophen-2-yl)amino]-2-oxoethyl] 2-(4-propanoylphenoxy)acetate.
| Compound Name | [2-[(3-carbamoylthiophen-2-yl)amino]-2-oxoethyl] 2-(4-propanoylphenoxy)acetate |
|---|---|
| PubChem CID | 2620779 |
| Molecular Formula | C18H18N2O6S |
| Molecular Weight | 390.42 g/mol |
| Exact Mass | 390.09 |
| IUPAC Name | [2-[(3-carbamoylthiophen-2-yl)amino]-2-oxoethyl] 2-(4-propanoylphenoxy)acetate |
| SMILES | CCC(=O)c1ccc(OCC(=O)OCC(=O)Nc2sccc2C(N)=O)cc1 |
| InChI | InChI=1S/C18H18N2O6S/c1-2-14(21)11-3-5-12(6-4-11)25-10-16(23)26-9-15(22)20-18-13(17(19)24)7-8-27-18/h3-8H,2,9-10H2,1H3,(H2,19,24)(H,20,22) |
| InChIKey | YFTFCRNLTQLOAH-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 124.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.42 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |