C20H25N5O6 — CID 26211770
(E)-N-[6-amino-1-(2-methylpropyl)-2,4-dioxopyrimidin-5-yl]-N-(2-methoxyethyl)-3-(3-nitrophenyl)prop-2-enamide (PubChem CID 26211770) has the molecular formula C20H25N5O6 and a molecular weight of 431.45 g/mol. Its IUPAC name is (E)-N-[6-amino-1-(2-methylpropyl)-2,4-dioxopyrimidin-5-yl]-N-(2-methoxyethyl)-3-(3-nitrophenyl)prop-2-enamide.
| Compound Name | (E)-N-[6-amino-1-(2-methylpropyl)-2,4-dioxopyrimidin-5-yl]-N-(2-methoxyethyl)-3-(3-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 26211770 |
| Molecular Formula | C20H25N5O6 |
| Molecular Weight | 431.45 g/mol |
| Exact Mass | 431.18 |
| IUPAC Name | (E)-N-[6-amino-1-(2-methylpropyl)-2,4-dioxopyrimidin-5-yl]-N-(2-methoxyethyl)-3-(3-nitrophenyl)prop-2-enamide |
| SMILES | COCCN(C(=O)/C=C/c1cccc([N+](=O)[O-])c1)c1c(N)n(CC(C)C)c(=O)[nH]c1=O |
| InChI | InChI=1S/C20H25N5O6/c1-13(2)12-24-18(21)17(19(27)22-20(24)28)23(9-10-31-3)16(26)8-7-14-5-4-6-15(11-14)25(29)30/h4-8,11,13H,9-10,12,21H2,1-3H3,(H,22,27,28)/b8-7+ |
| InChIKey | WBDNIJNJBRSSOO-BQYQJAHWSA-N |
| XLogP | 1.38 |
| TPSA | 153.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.45 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|