C21H26Cl2N4O4 — CID 26181942
(E)-N-[6-amino-1-(2-methylpropyl)-2,4-dioxopyrimidin-5-yl]-3-(3,4-dichlorophenyl)-N-(3-methoxypropyl)prop-2-enamide (PubChem CID 26181942) has the molecular formula C21H26Cl2N4O4 and a molecular weight of 469.37 g/mol. Its IUPAC name is (E)-N-[6-amino-1-(2-methylpropyl)-2,4-dioxopyrimidin-5-yl]-3-(3,4-dichlorophenyl)-N-(3-methoxypropyl)prop-2-enamide.
| Compound Name | (E)-N-[6-amino-1-(2-methylpropyl)-2,4-dioxopyrimidin-5-yl]-3-(3,4-dichlorophenyl)-N-(3-methoxypropyl)prop-2-enamide |
|---|---|
| PubChem CID | 26181942 |
| Molecular Formula | C21H26Cl2N4O4 |
| Molecular Weight | 469.37 g/mol |
| Exact Mass | 468.13 |
| IUPAC Name | (E)-N-[6-amino-1-(2-methylpropyl)-2,4-dioxopyrimidin-5-yl]-3-(3,4-dichlorophenyl)-N-(3-methoxypropyl)prop-2-enamide |
| SMILES | COCCCN(C(=O)/C=C/c1ccc(Cl)c(Cl)c1)c1c(N)n(CC(C)C)c(=O)[nH]c1=O |
| InChI | InChI=1S/C21H26Cl2N4O4/c1-13(2)12-27-19(24)18(20(29)25-21(27)30)26(9-4-10-31-3)17(28)8-6-14-5-7-15(22)16(23)11-14/h5-8,11,13H,4,9-10,12,24H2,1-3H3,(H,25,29,30)/b8-6+ |
| InChIKey | ACNANLFQYBLVKS-SOFGYWHQSA-N |
| XLogP | 3.16 |
| TPSA | 110.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.37 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|