C16H28N4O4 — CID 17480203
N-[6-amino-1-(2-methylpropyl)-2,4-dioxopyrimidin-5-yl]-N-(3-methoxypropyl)-2-methylpropanamide (PubChem CID 17480203) has the molecular formula C16H28N4O4 and a molecular weight of 340.42 g/mol. Its IUPAC name is N-[6-amino-1-(2-methylpropyl)-2,4-dioxopyrimidin-5-yl]-N-(3-methoxypropyl)-2-methylpropanamide.
| Compound Name | N-[6-amino-1-(2-methylpropyl)-2,4-dioxopyrimidin-5-yl]-N-(3-methoxypropyl)-2-methylpropanamide |
|---|---|
| PubChem CID | 17480203 |
| Molecular Formula | C16H28N4O4 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.21 |
| IUPAC Name | N-[6-amino-1-(2-methylpropyl)-2,4-dioxopyrimidin-5-yl]-N-(3-methoxypropyl)-2-methylpropanamide |
| SMILES | COCCCN(C(=O)C(C)C)c1c(N)n(CC(C)C)c(=O)[nH]c1=O |
| InChI | InChI=1S/C16H28N4O4/c1-10(2)9-20-13(17)12(14(21)18-16(20)23)19(7-6-8-24-5)15(22)11(3)4/h10-11H,6-9,17H2,1-5H3,(H,18,21,23) |
| InChIKey | LCPZQVSEGJOBAW-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 110.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|