C24H36N4O5 — CID 26183852
N-[6-amino-1-(2-methylpropyl)-2,4-dioxopyrimidin-5-yl]-2-(4-tert-butylphenoxy)-N-(3-methoxypropyl)acetamide (PubChem CID 26183852) has the molecular formula C24H36N4O5 and a molecular weight of 460.58 g/mol. Its IUPAC name is N-[6-amino-1-(2-methylpropyl)-2,4-dioxopyrimidin-5-yl]-2-(4-tert-butylphenoxy)-N-(3-methoxypropyl)acetamide.
| Compound Name | N-[6-amino-1-(2-methylpropyl)-2,4-dioxopyrimidin-5-yl]-2-(4-tert-butylphenoxy)-N-(3-methoxypropyl)acetamide |
|---|---|
| PubChem CID | 26183852 |
| Molecular Formula | C24H36N4O5 |
| Molecular Weight | 460.58 g/mol |
| Exact Mass | 460.27 |
| IUPAC Name | N-[6-amino-1-(2-methylpropyl)-2,4-dioxopyrimidin-5-yl]-2-(4-tert-butylphenoxy)-N-(3-methoxypropyl)acetamide |
| SMILES | COCCCN(C(=O)COc1ccc(C(C)(C)C)cc1)c1c(N)n(CC(C)C)c(=O)[nH]c1=O |
| InChI | InChI=1S/C24H36N4O5/c1-16(2)14-28-21(25)20(22(30)26-23(28)31)27(12-7-13-32-6)19(29)15-33-18-10-8-17(9-11-18)24(3,4)5/h8-11,16H,7,12-15,25H2,1-6H3,(H,26,30,31) |
| InChIKey | IQYFJPDGFOHXCI-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 119.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.58 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|