C20H27FN4O4S — CID 26183585
N-[6-amino-1-(2-methylpropyl)-2,4-dioxopyrimidin-5-yl]-2-(2-fluorophenyl)sulfanyl-N-(3-methoxypropyl)acetamide (PubChem CID 26183585) has the molecular formula C20H27FN4O4S and a molecular weight of 438.53 g/mol. Its IUPAC name is N-[6-amino-1-(2-methylpropyl)-2,4-dioxopyrimidin-5-yl]-2-(2-fluorophenyl)sulfanyl-N-(3-methoxypropyl)acetamide.
| Compound Name | N-[6-amino-1-(2-methylpropyl)-2,4-dioxopyrimidin-5-yl]-2-(2-fluorophenyl)sulfanyl-N-(3-methoxypropyl)acetamide |
|---|---|
| PubChem CID | 26183585 |
| Molecular Formula | C20H27FN4O4S |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.17 |
| IUPAC Name | N-[6-amino-1-(2-methylpropyl)-2,4-dioxopyrimidin-5-yl]-2-(2-fluorophenyl)sulfanyl-N-(3-methoxypropyl)acetamide |
| SMILES | COCCCN(C(=O)CSc1ccccc1F)c1c(N)n(CC(C)C)c(=O)[nH]c1=O |
| InChI | InChI=1S/C20H27FN4O4S/c1-13(2)11-25-18(22)17(19(27)23-20(25)28)24(9-6-10-29-3)16(26)12-30-15-8-5-4-7-14(15)21/h4-5,7-8,13H,6,9-12,22H2,1-3H3,(H,23,27,28) |
| InChIKey | ZZAPENOCOXNOHS-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 110.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|