C17H30N4O6 — CID 43037608
N-[6-amino-1-(2-methylpropyl)-2,4-dioxopyrimidin-5-yl]-2-(2-methoxyethoxy)-N-(3-methoxypropyl)acetamide (PubChem CID 43037608) has the molecular formula C17H30N4O6 and a molecular weight of 386.45 g/mol. Its IUPAC name is N-[6-amino-1-(2-methylpropyl)-2,4-dioxopyrimidin-5-yl]-2-(2-methoxyethoxy)-N-(3-methoxypropyl)acetamide.
| Compound Name | N-[6-amino-1-(2-methylpropyl)-2,4-dioxopyrimidin-5-yl]-2-(2-methoxyethoxy)-N-(3-methoxypropyl)acetamide |
|---|---|
| PubChem CID | 43037608 |
| Molecular Formula | C17H30N4O6 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.22 |
| IUPAC Name | N-[6-amino-1-(2-methylpropyl)-2,4-dioxopyrimidin-5-yl]-2-(2-methoxyethoxy)-N-(3-methoxypropyl)acetamide |
| SMILES | COCCCN(C(=O)COCCOC)c1c(N)n(CC(C)C)c(=O)[nH]c1=O |
| InChI | InChI=1S/C17H30N4O6/c1-12(2)10-21-15(18)14(16(23)19-17(21)24)20(6-5-7-25-3)13(22)11-27-9-8-26-4/h12H,5-11,18H2,1-4H3,(H,19,23,24) |
| InChIKey | LNJBKVQKXDBPTF-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 128.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|