C22H30N4O7 — CID 55874466
methyl 2-[3-[[6-amino-1-(2-methylpropyl)-2,4-dioxopyrimidin-5-yl]-(3-methoxypropyl)carbamoyl]phenoxy]acetate (PubChem CID 55874466) has the molecular formula C22H30N4O7 and a molecular weight of 462.50 g/mol. Its IUPAC name is methyl 2-[3-[[6-amino-1-(2-methylpropyl)-2,4-dioxopyrimidin-5-yl]-(3-methoxypropyl)carbamoyl]phenoxy]acetate.
| Compound Name | methyl 2-[3-[[6-amino-1-(2-methylpropyl)-2,4-dioxopyrimidin-5-yl]-(3-methoxypropyl)carbamoyl]phenoxy]acetate |
|---|---|
| PubChem CID | 55874466 |
| Molecular Formula | C22H30N4O7 |
| Molecular Weight | 462.50 g/mol |
| Exact Mass | 462.21 |
| IUPAC Name | methyl 2-[3-[[6-amino-1-(2-methylpropyl)-2,4-dioxopyrimidin-5-yl]-(3-methoxypropyl)carbamoyl]phenoxy]acetate |
| SMILES | COCCCN(C(=O)c1cccc(OCC(=O)OC)c1)c1c(N)n(CC(C)C)c(=O)[nH]c1=O |
| InChI | InChI=1S/C22H30N4O7/c1-14(2)12-26-19(23)18(20(28)24-22(26)30)25(9-6-10-31-3)21(29)15-7-5-8-16(11-15)33-13-17(27)32-4/h5,7-8,11,14H,6,9-10,12-13,23H2,1-4H3,(H,24,28,30) |
| InChIKey | IJODYWJNTGSWFA-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 145.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.50 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|