C23H31N5O3 — CID 26213593
2-[8-(1H-indol-2-ylmethyl)-1-(3-methylbutyl)-2,4-dioxo-1,3,8-triazaspiro[4.5]decan-3-yl]acetamide (PubChem CID 26213593) has the molecular formula C23H31N5O3 and a molecular weight of 425.53 g/mol. Its IUPAC name is 2-[8-(1H-indol-2-ylmethyl)-1-(3-methylbutyl)-2,4-dioxo-1,3,8-triazaspiro[4.5]decan-3-yl]acetamide.
| Compound Name | 2-[8-(1H-indol-2-ylmethyl)-1-(3-methylbutyl)-2,4-dioxo-1,3,8-triazaspiro[4.5]decan-3-yl]acetamide |
|---|---|
| PubChem CID | 26213593 |
| Molecular Formula | C23H31N5O3 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.24 |
| IUPAC Name | 2-[8-(1H-indol-2-ylmethyl)-1-(3-methylbutyl)-2,4-dioxo-1,3,8-triazaspiro[4.5]decan-3-yl]acetamide |
| SMILES | CC(C)CCN1C(=O)N(CC(N)=O)C(=O)C12CCN(Cc1cc3ccccc3[nH]1)CC2 |
| InChI | InChI=1S/C23H31N5O3/c1-16(2)7-10-28-22(31)27(15-20(24)29)21(30)23(28)8-11-26(12-9-23)14-18-13-17-5-3-4-6-19(17)25-18/h3-6,13,16,25H,7-12,14-15H2,1-2H3,(H2,24,29) |
| InChIKey | YQTVYWFFWJEOMX-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 102.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|