C22H21N3O4S3 — CID 26216114
N-[(4-cyanophenyl)methyl]-N-(3-pyrrolidin-1-ylsulfonylphenyl)thiophene-2-sulfonamide (PubChem CID 26216114) has the molecular formula C22H21N3O4S3 and a molecular weight of 487.63 g/mol. Its IUPAC name is N-[(4-cyanophenyl)methyl]-N-(3-pyrrolidin-1-ylsulfonylphenyl)thiophene-2-sulfonamide.
| Compound Name | N-[(4-cyanophenyl)methyl]-N-(3-pyrrolidin-1-ylsulfonylphenyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 26216114 |
| Molecular Formula | C22H21N3O4S3 |
| Molecular Weight | 487.63 g/mol |
| Exact Mass | 487.07 |
| IUPAC Name | N-[(4-cyanophenyl)methyl]-N-(3-pyrrolidin-1-ylsulfonylphenyl)thiophene-2-sulfonamide |
| SMILES | N#Cc1ccc(CN(c2cccc(S(=O)(=O)N3CCCC3)c2)S(=O)(=O)c2cccs2)cc1 |
| InChI | InChI=1S/C22H21N3O4S3/c23-16-18-8-10-19(11-9-18)17-25(32(28,29)22-7-4-14-30-22)20-5-3-6-21(15-20)31(26,27)24-12-1-2-13-24/h3-11,14-15H,1-2,12-13,17H2 |
| InChIKey | JMXYVTPYBYUHGQ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 98.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.63 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |