C24H23N3O4S2 — CID 26222119
3-(1-benzothiophen-2-ylmethylamino)-N-(4-methoxyphenyl)-5-(methylsulfamoyl)benzamide (PubChem CID 26222119) has the molecular formula C24H23N3O4S2 and a molecular weight of 481.60 g/mol. Its IUPAC name is 3-(1-benzothiophen-2-ylmethylamino)-N-(4-methoxyphenyl)-5-(methylsulfamoyl)benzamide.
| Compound Name | 3-(1-benzothiophen-2-ylmethylamino)-N-(4-methoxyphenyl)-5-(methylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 26222119 |
| Molecular Formula | C24H23N3O4S2 |
| Molecular Weight | 481.60 g/mol |
| Exact Mass | 481.11 |
| IUPAC Name | 3-(1-benzothiophen-2-ylmethylamino)-N-(4-methoxyphenyl)-5-(methylsulfamoyl)benzamide |
| SMILES | CNS(=O)(=O)c1cc(NCc2cc3ccccc3s2)cc(C(=O)Nc2ccc(OC)cc2)c1 |
| InChI | InChI=1S/C24H23N3O4S2/c1-25-33(29,30)22-13-17(24(28)27-18-7-9-20(31-2)10-8-18)11-19(14-22)26-15-21-12-16-5-3-4-6-23(16)32-21/h3-14,25-26H,15H2,1-2H3,(H,27,28) |
| InChIKey | LEHUOAKNHCIZOB-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.60 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |