C25H28FN3O4S — CID 26137585
3-(tert-butylsulfamoyl)-N-(3-fluorophenyl)-5-[(3-methoxyphenyl)methylamino]benzamide (PubChem CID 26137585) has the molecular formula C25H28FN3O4S and a molecular weight of 485.58 g/mol. Its IUPAC name is 3-(tert-butylsulfamoyl)-N-(3-fluorophenyl)-5-[(3-methoxyphenyl)methylamino]benzamide.
| Compound Name | 3-(tert-butylsulfamoyl)-N-(3-fluorophenyl)-5-[(3-methoxyphenyl)methylamino]benzamide |
|---|---|
| PubChem CID | 26137585 |
| Molecular Formula | C25H28FN3O4S |
| Molecular Weight | 485.58 g/mol |
| Exact Mass | 485.18 |
| IUPAC Name | 3-(tert-butylsulfamoyl)-N-(3-fluorophenyl)-5-[(3-methoxyphenyl)methylamino]benzamide |
| SMILES | COc1cccc(CNc2cc(C(=O)Nc3cccc(F)c3)cc(S(=O)(=O)NC(C)(C)C)c2)c1 |
| InChI | InChI=1S/C25H28FN3O4S/c1-25(2,3)29-34(31,32)23-13-18(24(30)28-20-9-6-8-19(26)14-20)12-21(15-23)27-16-17-7-5-10-22(11-17)33-4/h5-15,27,29H,16H2,1-4H3,(H,28,30) |
| InChIKey | FLUHQWKOGLXCBD-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.58 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |