C22H33N3O2 — CID 26227927
(6S)-1-cyclohexyl-4-(3-methylbut-2-enyl)-6-(pyridin-2-ylmethoxy)-1,4-diazepan-2-one (PubChem CID 26227927) has the molecular formula C22H33N3O2 and a molecular weight of 371.53 g/mol. Its IUPAC name is (6S)-1-cyclohexyl-4-(3-methylbut-2-enyl)-6-(pyridin-2-ylmethoxy)-1,4-diazepan-2-one.
| Compound Name | (6S)-1-cyclohexyl-4-(3-methylbut-2-enyl)-6-(pyridin-2-ylmethoxy)-1,4-diazepan-2-one |
|---|---|
| PubChem CID | 26227927 |
| Molecular Formula | C22H33N3O2 |
| Molecular Weight | 371.53 g/mol |
| Exact Mass | 371.26 |
| IUPAC Name | (6S)-1-cyclohexyl-4-(3-methylbut-2-enyl)-6-(pyridin-2-ylmethoxy)-1,4-diazepan-2-one |
| SMILES | CC(C)=CCN1CC(=O)N(C2CCCCC2)C[C@@H](OCc2ccccn2)C1 |
| InChI | InChI=1S/C22H33N3O2/c1-18(2)11-13-24-14-21(27-17-19-8-6-7-12-23-19)15-25(22(26)16-24)20-9-4-3-5-10-20/h6-8,11-12,20-21H,3-5,9-10,13-17H2,1-2H3/t21-/m0/s1 |
| InChIKey | VMLUMMYVAUJRMV-NRFANRHFSA-N |
| XLogP | 3.41 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.53 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|