About 5-amino-2-decoxybenzoic acid
5-amino-2-decoxybenzoic acid (PubChem CID 26242) has the molecular formula C17H27NO3
and a molecular weight of 293.41 g/mol. Its IUPAC name is 5-amino-2-decoxybenzoic acid.
Molecular Properties
| Compound Name | 5-amino-2-decoxybenzoic acid |
| PubChem CID | 26242 |
| Molecular Formula | C17H27NO3 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.20 |
| IUPAC Name | 5-amino-2-decoxybenzoic acid |
| SMILES | CCCCCCCCCCOc1ccc(N)cc1C(=O)O |
| InChI | InChI=1S/C17H27NO3/c1-2-3-4-5-6-7-8-9-12-21-16-11-10-14(18)13-15(16)17(19)20/h10-11,13H,2-9,12,18H2,1H3,(H,19,20) |
| InChIKey | JHDAGEWGMFQUAC-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 5-amino-2-decoxybenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-2-decoxybenzoic acid?
The IUPAC name of 5-amino-2-decoxybenzoic acid (CID 26242) is 5-amino-2-decoxybenzoic acid.
What is the SMILES notation for 5-amino-2-decoxybenzoic acid?
The canonical SMILES for 5-amino-2-decoxybenzoic acid is CCCCCCCCCCOc1ccc(N)cc1C(=O)O.
What is the InChIKey of 5-amino-2-decoxybenzoic acid?
The InChIKey is JHDAGEWGMFQUAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H27NO3/c1-2-3-4-5-6-7-8-9-12-21-16-11-10-14(18)13-15(16)17(19)20/h10-11,13H,2-9,12,18H2,1H3,(H,19,20).
What are the key properties of 5-amino-2-decoxybenzoic acid?
5-amino-2-decoxybenzoic acid has a molecular weight of 293.41 g/mol, XLogP of 4.49, 11 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-2-decoxybenzoic acid is sourced from PubChem (CID 26242), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).