C19H24N2O3S — CID 26247512
ethyl 3,5-dimethyl-4-[2-(4-methylphenyl)sulfanylethylcarbamoyl]-1H-pyrrole-2-carboxylate (PubChem CID 26247512) has the molecular formula C19H24N2O3S and a molecular weight of 360.48 g/mol. Its IUPAC name is ethyl 3,5-dimethyl-4-[2-(4-methylphenyl)sulfanylethylcarbamoyl]-1H-pyrrole-2-carboxylate.
| Compound Name | ethyl 3,5-dimethyl-4-[2-(4-methylphenyl)sulfanylethylcarbamoyl]-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 26247512 |
| Molecular Formula | C19H24N2O3S |
| Molecular Weight | 360.48 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | ethyl 3,5-dimethyl-4-[2-(4-methylphenyl)sulfanylethylcarbamoyl]-1H-pyrrole-2-carboxylate |
| SMILES | CCOC(=O)c1[nH]c(C)c(C(=O)NCCSc2ccc(C)cc2)c1C |
| InChI | InChI=1S/C19H24N2O3S/c1-5-24-19(23)17-13(3)16(14(4)21-17)18(22)20-10-11-25-15-8-6-12(2)7-9-15/h6-9,21H,5,10-11H2,1-4H3,(H,20,22) |
| InChIKey | BMISLMJEVCXLAR-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.48 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|