C18H21ClN2O4 — CID 30502854
ethyl 4-[2-(4-chlorophenoxy)ethylcarbamoyl]-3,5-dimethyl-1H-pyrrole-2-carboxylate (PubChem CID 30502854) has the molecular formula C18H21ClN2O4 and a molecular weight of 364.83 g/mol. Its IUPAC name is ethyl 4-[2-(4-chlorophenoxy)ethylcarbamoyl]-3,5-dimethyl-1H-pyrrole-2-carboxylate.
| Compound Name | ethyl 4-[2-(4-chlorophenoxy)ethylcarbamoyl]-3,5-dimethyl-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 30502854 |
| Molecular Formula | C18H21ClN2O4 |
| Molecular Weight | 364.83 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | ethyl 4-[2-(4-chlorophenoxy)ethylcarbamoyl]-3,5-dimethyl-1H-pyrrole-2-carboxylate |
| SMILES | CCOC(=O)c1[nH]c(C)c(C(=O)NCCOc2ccc(Cl)cc2)c1C |
| InChI | InChI=1S/C18H21ClN2O4/c1-4-24-18(23)16-11(2)15(12(3)21-16)17(22)20-9-10-25-14-7-5-13(19)6-8-14/h5-8,21H,4,9-10H2,1-3H3,(H,20,22) |
| InChIKey | RFJJLIOOZIEHEF-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 80.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.83 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|