C17H14BrFN2O4 — CID 2625840
[2-[[2-(4-fluoroanilino)-2-oxoethyl]amino]-2-oxoethyl] 4-bromobenzoate (PubChem CID 2625840) has the molecular formula C17H14BrFN2O4 and a molecular weight of 409.21 g/mol. Its IUPAC name is [2-[[2-(4-fluoroanilino)-2-oxoethyl]amino]-2-oxoethyl] 4-bromobenzoate.
| Compound Name | [2-[[2-(4-fluoroanilino)-2-oxoethyl]amino]-2-oxoethyl] 4-bromobenzoate |
|---|---|
| PubChem CID | 2625840 |
| Molecular Formula | C17H14BrFN2O4 |
| Molecular Weight | 409.21 g/mol |
| Exact Mass | 408.01 |
| IUPAC Name | [2-[[2-(4-fluoroanilino)-2-oxoethyl]amino]-2-oxoethyl] 4-bromobenzoate |
| SMILES | O=C(COC(=O)c1ccc(Br)cc1)NCC(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C17H14BrFN2O4/c18-12-3-1-11(2-4-12)17(24)25-10-16(23)20-9-15(22)21-14-7-5-13(19)6-8-14/h1-8H,9-10H2,(H,20,23)(H,21,22) |
| InChIKey | UGAJPUVJLQZNJB-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.21 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |