C16H14FN3O4 — CID 7478174
[2-[[2-(4-fluoroanilino)-2-oxoethyl]amino]-2-oxoethyl] pyridine-4-carboxylate (PubChem CID 7478174) has the molecular formula C16H14FN3O4 and a molecular weight of 331.30 g/mol. Its IUPAC name is [2-[[2-(4-fluoroanilino)-2-oxoethyl]amino]-2-oxoethyl] pyridine-4-carboxylate.
| Compound Name | [2-[[2-(4-fluoroanilino)-2-oxoethyl]amino]-2-oxoethyl] pyridine-4-carboxylate |
|---|---|
| PubChem CID | 7478174 |
| Molecular Formula | C16H14FN3O4 |
| Molecular Weight | 331.30 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | [2-[[2-(4-fluoroanilino)-2-oxoethyl]amino]-2-oxoethyl] pyridine-4-carboxylate |
| SMILES | O=C(COC(=O)c1ccncc1)NCC(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C16H14FN3O4/c17-12-1-3-13(4-2-12)20-14(21)9-19-15(22)10-24-16(23)11-5-7-18-8-6-11/h1-8H,9-10H2,(H,19,22)(H,20,21) |
| InChIKey | OHRMBKYBTXLDTB-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.30 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |