C19H19N5O3 — CID 26262559
3-(dimethylamino)-N'-[2-(2-oxoquinoxalin-1-yl)acetyl]benzohydrazide (PubChem CID 26262559) has the molecular formula C19H19N5O3 and a molecular weight of 365.39 g/mol. Its IUPAC name is 3-(dimethylamino)-N'-[2-(2-oxoquinoxalin-1-yl)acetyl]benzohydrazide.
| Compound Name | 3-(dimethylamino)-N'-[2-(2-oxoquinoxalin-1-yl)acetyl]benzohydrazide |
|---|---|
| PubChem CID | 26262559 |
| Molecular Formula | C19H19N5O3 |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.15 |
| IUPAC Name | 3-(dimethylamino)-N'-[2-(2-oxoquinoxalin-1-yl)acetyl]benzohydrazide |
| SMILES | CN(C)c1cccc(C(=O)NNC(=O)Cn2c(=O)cnc3ccccc32)c1 |
| InChI | InChI=1S/C19H19N5O3/c1-23(2)14-7-5-6-13(10-14)19(27)22-21-17(25)12-24-16-9-4-3-8-15(16)20-11-18(24)26/h3-11H,12H2,1-2H3,(H,21,25)(H,22,27) |
| InChIKey | RWDVPLAHLRRDPF-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 96.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|