C18H16N2O3 — CID 2626397
[(2R)-1-(4-methylanilino)-1-oxopropan-2-yl] 3-cyanobenzoate (PubChem CID 2626397) has the molecular formula C18H16N2O3 and a molecular weight of 308.34 g/mol. Its IUPAC name is [(2R)-1-(4-methylanilino)-1-oxopropan-2-yl] 3-cyanobenzoate.
| Compound Name | [(2R)-1-(4-methylanilino)-1-oxopropan-2-yl] 3-cyanobenzoate |
|---|---|
| PubChem CID | 2626397 |
| Molecular Formula | C18H16N2O3 |
| Molecular Weight | 308.34 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | [(2R)-1-(4-methylanilino)-1-oxopropan-2-yl] 3-cyanobenzoate |
| SMILES | Cc1ccc(NC(=O)[C@@H](C)OC(=O)c2cccc(C#N)c2)cc1 |
| InChI | InChI=1S/C18H16N2O3/c1-12-6-8-16(9-7-12)20-17(21)13(2)23-18(22)15-5-3-4-14(10-15)11-19/h3-10,13H,1-2H3,(H,20,21)/t13-/m1/s1 |
| InChIKey | PUFDMLLRBYNMSP-CYBMUJFWSA-N |
| XLogP | 3.05 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.34 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |