C24H31N3O5S — CID 26267069
4-(2-ethoxyphenoxy)-N-[4-(3,4,5,6-tetrahydro-2H-azepin-7-ylsulfamoyl)phenyl]butanamide (PubChem CID 26267069) has the molecular formula C24H31N3O5S and a molecular weight of 473.60 g/mol. Its IUPAC name is 4-(2-ethoxyphenoxy)-N-[4-(3,4,5,6-tetrahydro-2H-azepin-7-ylsulfamoyl)phenyl]butanamide.
| Compound Name | 4-(2-ethoxyphenoxy)-N-[4-(3,4,5,6-tetrahydro-2H-azepin-7-ylsulfamoyl)phenyl]butanamide |
|---|---|
| PubChem CID | 26267069 |
| Molecular Formula | C24H31N3O5S |
| Molecular Weight | 473.60 g/mol |
| Exact Mass | 473.20 |
| IUPAC Name | 4-(2-ethoxyphenoxy)-N-[4-(3,4,5,6-tetrahydro-2H-azepin-7-ylsulfamoyl)phenyl]butanamide |
| SMILES | CCOc1ccccc1OCCCC(=O)Nc1ccc(S(=O)(=O)NC2=NCCCCC2)cc1 |
| InChI | InChI=1S/C24H31N3O5S/c1-2-31-21-9-5-6-10-22(21)32-18-8-12-24(28)26-19-13-15-20(16-14-19)33(29,30)27-23-11-4-3-7-17-25-23/h5-6,9-10,13-16H,2-4,7-8,11-12,17-18H2,1H3,(H,25,27)(H,26,28) |
| InChIKey | TXCZCUOJHWJACH-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 106.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.60 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|