C24H28N2O3 — CID 26274628
(3-prop-2-enoxyphenyl)-[7-(pyrrolidin-1-ylmethyl)-3,5-dihydro-2H-1,4-benzoxazepin-4-yl]methanone (PubChem CID 26274628) has the molecular formula C24H28N2O3 and a molecular weight of 392.50 g/mol. Its IUPAC name is (3-prop-2-enoxyphenyl)-[7-(pyrrolidin-1-ylmethyl)-3,5-dihydro-2H-1,4-benzoxazepin-4-yl]methanone.
| Compound Name | (3-prop-2-enoxyphenyl)-[7-(pyrrolidin-1-ylmethyl)-3,5-dihydro-2H-1,4-benzoxazepin-4-yl]methanone |
|---|---|
| PubChem CID | 26274628 |
| Molecular Formula | C24H28N2O3 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.21 |
| IUPAC Name | (3-prop-2-enoxyphenyl)-[7-(pyrrolidin-1-ylmethyl)-3,5-dihydro-2H-1,4-benzoxazepin-4-yl]methanone |
| SMILES | C=CCOc1cccc(C(=O)N2CCOc3ccc(CN4CCCC4)cc3C2)c1 |
| InChI | InChI=1S/C24H28N2O3/c1-2-13-28-22-7-5-6-20(16-22)24(27)26-12-14-29-23-9-8-19(15-21(23)18-26)17-25-10-3-4-11-25/h2,5-9,15-16H,1,3-4,10-14,17-18H2 |
| InChIKey | WYMPJTYYXCZHHG-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|