C27H28ClN5S — CID 26280234
6-[[4-[5-[(3-chlorophenyl)methylsulfanyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]piperidin-1-yl]methyl]quinoline (PubChem CID 26280234) has the molecular formula C27H28ClN5S and a molecular weight of 490.08 g/mol. Its IUPAC name is 6-[[4-[5-[(3-chlorophenyl)methylsulfanyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]piperidin-1-yl]methyl]quinoline.
| Compound Name | 6-[[4-[5-[(3-chlorophenyl)methylsulfanyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]piperidin-1-yl]methyl]quinoline |
|---|---|
| PubChem CID | 26280234 |
| Molecular Formula | C27H28ClN5S |
| Molecular Weight | 490.08 g/mol |
| Exact Mass | 489.18 |
| IUPAC Name | 6-[[4-[5-[(3-chlorophenyl)methylsulfanyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]piperidin-1-yl]methyl]quinoline |
| SMILES | C=CCn1c(SCc2cccc(Cl)c2)nnc1C1CCN(Cc2ccc3ncccc3c2)CC1 |
| InChI | InChI=1S/C27H28ClN5S/c1-2-13-33-26(30-31-27(33)34-19-21-5-3-7-24(28)17-21)22-10-14-32(15-11-22)18-20-8-9-25-23(16-20)6-4-12-29-25/h2-9,12,16-17,22H,1,10-11,13-15,18-19H2 |
| InChIKey | HJHMFFZXGIPBFR-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.08 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|