C25H33N3O5S — CID 26292496
N-[2-(dimethylamino)-5-piperidin-1-ylsulfonylphenyl]-2-(2-methoxy-4-prop-2-enylphenoxy)acetamide (PubChem CID 26292496) has the molecular formula C25H33N3O5S and a molecular weight of 487.62 g/mol. Its IUPAC name is N-[2-(dimethylamino)-5-piperidin-1-ylsulfonylphenyl]-2-(2-methoxy-4-prop-2-enylphenoxy)acetamide.
| Compound Name | N-[2-(dimethylamino)-5-piperidin-1-ylsulfonylphenyl]-2-(2-methoxy-4-prop-2-enylphenoxy)acetamide |
|---|---|
| PubChem CID | 26292496 |
| Molecular Formula | C25H33N3O5S |
| Molecular Weight | 487.62 g/mol |
| Exact Mass | 487.21 |
| IUPAC Name | N-[2-(dimethylamino)-5-piperidin-1-ylsulfonylphenyl]-2-(2-methoxy-4-prop-2-enylphenoxy)acetamide |
| SMILES | C=CCc1ccc(OCC(=O)Nc2cc(S(=O)(=O)N3CCCCC3)ccc2N(C)C)c(OC)c1 |
| InChI | InChI=1S/C25H33N3O5S/c1-5-9-19-10-13-23(24(16-19)32-4)33-18-25(29)26-21-17-20(11-12-22(21)27(2)3)34(30,31)28-14-7-6-8-15-28/h5,10-13,16-17H,1,6-9,14-15,18H2,2-4H3,(H,26,29) |
| InChIKey | DXJHDOVVICIFIY-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.62 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|