C18H18N6O2 — CID 26295234
N-[(2,3-dimethylphenyl)carbamoyl]-2-(5-phenyltetrazol-2-yl)acetamide (PubChem CID 26295234) has the molecular formula C18H18N6O2 and a molecular weight of 350.38 g/mol. Its IUPAC name is N-[(2,3-dimethylphenyl)carbamoyl]-2-(5-phenyltetrazol-2-yl)acetamide.
| Compound Name | N-[(2,3-dimethylphenyl)carbamoyl]-2-(5-phenyltetrazol-2-yl)acetamide |
|---|---|
| PubChem CID | 26295234 |
| Molecular Formula | C18H18N6O2 |
| Molecular Weight | 350.38 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | N-[(2,3-dimethylphenyl)carbamoyl]-2-(5-phenyltetrazol-2-yl)acetamide |
| SMILES | Cc1cccc(NC(=O)NC(=O)Cn2nnc(-c3ccccc3)n2)c1C |
| InChI | InChI=1S/C18H18N6O2/c1-12-7-6-10-15(13(12)2)19-18(26)20-16(25)11-24-22-17(21-23-24)14-8-4-3-5-9-14/h3-10H,11H2,1-2H3,(H2,19,20,25,26) |
| InChIKey | DPIXITNGMXMPMI-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 101.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.38 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |