C15H19N5O3S — CID 2630185
butyl 4-[[2-(1-methyltetrazol-5-yl)sulfanylacetyl]amino]benzoate (PubChem CID 2630185) has the molecular formula C15H19N5O3S and a molecular weight of 349.42 g/mol. Its IUPAC name is butyl 4-[[2-(1-methyltetrazol-5-yl)sulfanylacetyl]amino]benzoate.
| Compound Name | butyl 4-[[2-(1-methyltetrazol-5-yl)sulfanylacetyl]amino]benzoate |
|---|---|
| PubChem CID | 2630185 |
| Molecular Formula | C15H19N5O3S |
| Molecular Weight | 349.42 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | butyl 4-[[2-(1-methyltetrazol-5-yl)sulfanylacetyl]amino]benzoate |
| SMILES | CCCCOC(=O)c1ccc(NC(=O)CSc2nnnn2C)cc1 |
| InChI | InChI=1S/C15H19N5O3S/c1-3-4-9-23-14(22)11-5-7-12(8-6-11)16-13(21)10-24-15-17-18-19-20(15)2/h5-8H,3-4,9-10H2,1-2H3,(H,16,21) |
| InChIKey | SPSREWRSLVRMBQ-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 99.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.42 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|