C12H13N5O3 — CID 24819796
ethyl 4-(1,2,4-triazol-4-ylcarbamoylamino)benzoate (PubChem CID 24819796) has the molecular formula C12H13N5O3 and a molecular weight of 275.27 g/mol. Its IUPAC name is ethyl 4-(1,2,4-triazol-4-ylcarbamoylamino)benzoate.
| Compound Name | ethyl 4-(1,2,4-triazol-4-ylcarbamoylamino)benzoate |
|---|---|
| PubChem CID | 24819796 |
| Molecular Formula | C12H13N5O3 |
| Molecular Weight | 275.27 g/mol |
| Exact Mass | 275.10 |
| IUPAC Name | ethyl 4-(1,2,4-triazol-4-ylcarbamoylamino)benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)Nn2cnnc2)cc1 |
| InChI | InChI=1S/C12H13N5O3/c1-2-20-11(18)9-3-5-10(6-4-9)15-12(19)16-17-7-13-14-8-17/h3-8H,2H2,1H3,(H2,15,16,19) |
| InChIKey | GYCKMDITTODYNC-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 98.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.27 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |