C19H18BrF3N2O4 — CID 26311942
2-(2-bromo-4,5-dimethoxyphenyl)-N-methyl-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]acetamide (PubChem CID 26311942) has the molecular formula C19H18BrF3N2O4 and a molecular weight of 475.26 g/mol. Its IUPAC name is 2-(2-bromo-4,5-dimethoxyphenyl)-N-methyl-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]acetamide.
| Compound Name | 2-(2-bromo-4,5-dimethoxyphenyl)-N-methyl-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]acetamide |
|---|---|
| PubChem CID | 26311942 |
| Molecular Formula | C19H18BrF3N2O4 |
| Molecular Weight | 475.26 g/mol |
| Exact Mass | 474.04 |
| IUPAC Name | 2-(2-bromo-4,5-dimethoxyphenyl)-N-methyl-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]acetamide |
| SMILES | COc1cc(Br)c(CC(=O)N(C)CC(=O)Nc2ccc(F)c(F)c2F)cc1OC |
| InChI | InChI=1S/C19H18BrF3N2O4/c1-25(9-16(26)24-13-5-4-12(21)18(22)19(13)23)17(27)7-10-6-14(28-2)15(29-3)8-11(10)20/h4-6,8H,7,9H2,1-3H3,(H,24,26) |
| InChIKey | CGSYQAOQNWGMTC-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.26 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|