C23H33N3O4S — CID 26313790
N-[(2R)-3-methyl-1-[4-(methylsulfamoyl)anilino]-1-oxobutan-2-yl]adamantane-1-carboxamide (PubChem CID 26313790) has the molecular formula C23H33N3O4S and a molecular weight of 447.60 g/mol. Its IUPAC name is N-[(2R)-3-methyl-1-[4-(methylsulfamoyl)anilino]-1-oxobutan-2-yl]adamantane-1-carboxamide.
| Compound Name | N-[(2R)-3-methyl-1-[4-(methylsulfamoyl)anilino]-1-oxobutan-2-yl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 26313790 |
| Molecular Formula | C23H33N3O4S |
| Molecular Weight | 447.60 g/mol |
| Exact Mass | 447.22 |
| IUPAC Name | N-[(2R)-3-methyl-1-[4-(methylsulfamoyl)anilino]-1-oxobutan-2-yl]adamantane-1-carboxamide |
| SMILES | CNS(=O)(=O)c1ccc(NC(=O)[C@H](NC(=O)C23CC4CC(CC(C4)C2)C3)C(C)C)cc1 |
| InChI | InChI=1S/C23H33N3O4S/c1-14(2)20(21(27)25-18-4-6-19(7-5-18)31(29,30)24-3)26-22(28)23-11-15-8-16(12-23)10-17(9-15)13-23/h4-7,14-17,20,24H,8-13H2,1-3H3,(H,25,27)(H,26,28)/t15?,16?,17?,20-,23?/m1/s1 |
| InChIKey | ZCFZCKNCVUKUGE-LZGZYFLISA-N |
| XLogP | 2.89 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.60 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |