C34H31NO4 — CID 26314725
[2-ethoxy-4-[(9R,12R)-11-oxo-9-phenyl-8,9,10,12-tetrahydro-7H-benzo[a]acridin-12-yl]phenyl] propanoate (PubChem CID 26314725) has the molecular formula C34H31NO4 and a molecular weight of 517.63 g/mol. Its IUPAC name is [2-ethoxy-4-[(9R,12R)-11-oxo-9-phenyl-8,9,10,12-tetrahydro-7H-benzo[a]acridin-12-yl]phenyl] propanoate.
| Compound Name | [2-ethoxy-4-[(9R,12R)-11-oxo-9-phenyl-8,9,10,12-tetrahydro-7H-benzo[a]acridin-12-yl]phenyl] propanoate |
|---|---|
| PubChem CID | 26314725 |
| Molecular Formula | C34H31NO4 |
| Molecular Weight | 517.63 g/mol |
| Exact Mass | 517.23 |
| IUPAC Name | [2-ethoxy-4-[(9R,12R)-11-oxo-9-phenyl-8,9,10,12-tetrahydro-7H-benzo[a]acridin-12-yl]phenyl] propanoate |
| SMILES | CCOc1cc([C@H]2C3=C(C[C@@H](c4ccccc4)CC3=O)Nc3ccc4ccccc4c32)ccc1OC(=O)CC |
| InChI | InChI=1S/C34H31NO4/c1-3-31(37)39-29-17-15-23(20-30(29)38-4-2)32-33-25-13-9-8-12-22(25)14-16-26(33)35-27-18-24(19-28(36)34(27)32)21-10-6-5-7-11-21/h5-17,20,24,32,35H,3-4,18-19H2,1-2H3/t24-,32-/m1/s1 |
| InChIKey | UDAHHXGCBCCPQD-GPNASLBKSA-N |
| XLogP | 7.51 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.63 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|