C32H33NO6 — CID 26314729
methyl (8S,12R)-12-(3-ethoxy-4-propanoyloxyphenyl)-9,9-dimethyl-11-oxo-7,8,10,12-tetrahydrobenzo[a]acridine-8-carboxylate (PubChem CID 26314729) has the molecular formula C32H33NO6 and a molecular weight of 527.62 g/mol. Its IUPAC name is methyl (8S,12R)-12-(3-ethoxy-4-propanoyloxyphenyl)-9,9-dimethyl-11-oxo-7,8,10,12-tetrahydrobenzo[a]acridine-8-carboxylate.
| Compound Name | methyl (8S,12R)-12-(3-ethoxy-4-propanoyloxyphenyl)-9,9-dimethyl-11-oxo-7,8,10,12-tetrahydrobenzo[a]acridine-8-carboxylate |
|---|---|
| PubChem CID | 26314729 |
| Molecular Formula | C32H33NO6 |
| Molecular Weight | 527.62 g/mol |
| Exact Mass | 527.23 |
| IUPAC Name | methyl (8S,12R)-12-(3-ethoxy-4-propanoyloxyphenyl)-9,9-dimethyl-11-oxo-7,8,10,12-tetrahydrobenzo[a]acridine-8-carboxylate |
| SMILES | CCOc1cc([C@H]2C3=C(Nc4ccc5ccccc5c42)[C@@H](C(=O)OC)C(C)(C)CC3=O)ccc1OC(=O)CC |
| InChI | InChI=1S/C32H33NO6/c1-6-25(35)39-23-15-13-19(16-24(23)38-7-2)26-27-20-11-9-8-10-18(20)12-14-21(27)33-30-28(26)22(34)17-32(3,4)29(30)31(36)37-5/h8-16,26,29,33H,6-7,17H2,1-5H3/t26-,29+/m1/s1 |
| InChIKey | LPZBWABDUVMDIF-UHSQPCAPSA-N |
| XLogP | 6.15 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.62 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|