C31H33NO4 — CID 40573434
[4-[(5S)-2,2-dimethyl-4-oxo-1,3,5,6-tetrahydrobenzo[a]phenanthridin-5-yl]-2-ethoxyphenyl] 2-methylpropanoate (PubChem CID 40573434) has the molecular formula C31H33NO4 and a molecular weight of 483.61 g/mol. Its IUPAC name is [4-[(5S)-2,2-dimethyl-4-oxo-1,3,5,6-tetrahydrobenzo[a]phenanthridin-5-yl]-2-ethoxyphenyl] 2-methylpropanoate.
| Compound Name | [4-[(5S)-2,2-dimethyl-4-oxo-1,3,5,6-tetrahydrobenzo[a]phenanthridin-5-yl]-2-ethoxyphenyl] 2-methylpropanoate |
|---|---|
| PubChem CID | 40573434 |
| Molecular Formula | C31H33NO4 |
| Molecular Weight | 483.61 g/mol |
| Exact Mass | 483.24 |
| IUPAC Name | [4-[(5S)-2,2-dimethyl-4-oxo-1,3,5,6-tetrahydrobenzo[a]phenanthridin-5-yl]-2-ethoxyphenyl] 2-methylpropanoate |
| SMILES | CCOc1cc([C@@H]2Nc3ccc4ccccc4c3C3=C2C(=O)CC(C)(C)C3)ccc1OC(=O)C(C)C |
| InChI | InChI=1S/C31H33NO4/c1-6-35-26-15-20(12-14-25(26)36-30(34)18(2)3)29-28-22(16-31(4,5)17-24(28)33)27-21-10-8-7-9-19(21)11-13-23(27)32-29/h7-15,18,29,32H,6,16-17H2,1-5H3/t29-/m0/s1 |
| InChIKey | IVAAXOSLJGMVAF-LJAQVGFWSA-N |
| XLogP | 7.11 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.61 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|