C33H38N2O4 — CID 4008965
[4-(11,11-dimethyl-9-oxo-7,8,10,12-tetrahydrobenzo[a][4,7]phenanthrolin-8-yl)-2-methoxyphenyl] octanoate (PubChem CID 4008965) has the molecular formula C33H38N2O4 and a molecular weight of 526.68 g/mol. Its IUPAC name is [4-(11,11-dimethyl-9-oxo-7,8,10,12-tetrahydrobenzo[a][4,7]phenanthrolin-8-yl)-2-methoxyphenyl] octanoate.
| Compound Name | [4-(11,11-dimethyl-9-oxo-7,8,10,12-tetrahydrobenzo[a][4,7]phenanthrolin-8-yl)-2-methoxyphenyl] octanoate |
|---|---|
| PubChem CID | 4008965 |
| Molecular Formula | C33H38N2O4 |
| Molecular Weight | 526.68 g/mol |
| Exact Mass | 526.28 |
| IUPAC Name | [4-(11,11-dimethyl-9-oxo-7,8,10,12-tetrahydrobenzo[a][4,7]phenanthrolin-8-yl)-2-methoxyphenyl] octanoate |
| SMILES | CCCCCCCC(=O)Oc1ccc(C2Nc3ccc4ncccc4c3C3=C2C(=O)CC(C)(C)C3)cc1OC |
| InChI | InChI=1S/C33H38N2O4/c1-5-6-7-8-9-12-29(37)39-27-16-13-21(18-28(27)38-4)32-31-23(19-33(2,3)20-26(31)36)30-22-11-10-17-34-24(22)14-15-25(30)35-32/h10-11,13-18,32,35H,5-9,12,19-20H2,1-4H3 |
| InChIKey | MACGOPXWFGMRRX-UHFFFAOYSA-N |
| XLogP | 7.82 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.68 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|