C29H29NO4 — CID 2945423
[2-methoxy-4-(4-oxo-2,3,5,6-tetrahydro-1H-benzo[a]phenanthridin-5-yl)phenyl] pentanoate (PubChem CID 2945423) has the molecular formula C29H29NO4 and a molecular weight of 455.55 g/mol. Its IUPAC name is [2-methoxy-4-(4-oxo-2,3,5,6-tetrahydro-1H-benzo[a]phenanthridin-5-yl)phenyl] pentanoate.
| Compound Name | [2-methoxy-4-(4-oxo-2,3,5,6-tetrahydro-1H-benzo[a]phenanthridin-5-yl)phenyl] pentanoate |
|---|---|
| PubChem CID | 2945423 |
| Molecular Formula | C29H29NO4 |
| Molecular Weight | 455.55 g/mol |
| Exact Mass | 455.21 |
| IUPAC Name | [2-methoxy-4-(4-oxo-2,3,5,6-tetrahydro-1H-benzo[a]phenanthridin-5-yl)phenyl] pentanoate |
| SMILES | CCCCC(=O)Oc1ccc(C2Nc3ccc4ccccc4c3C3=C2C(=O)CCC3)cc1OC |
| InChI | InChI=1S/C29H29NO4/c1-3-4-12-26(32)34-24-16-14-19(17-25(24)33-2)29-28-21(10-7-11-23(28)31)27-20-9-6-5-8-18(20)13-15-22(27)30-29/h5-6,8-9,13-17,29-30H,3-4,7,10-12H2,1-2H3 |
| InChIKey | ASQONWYMLGDCSV-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.55 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|